C11H11NS2 — CID 163678098
(2E,4Z)-4-sulfanyl-2-thiophen-2-ylhepta-2,4-dienenitrile (PubChem CID 163678098) has the molecular formula C11H11NS2 and a molecular weight of 221.35 g/mol. Its IUPAC name is (2E,4Z)-4-sulfanyl-2-thiophen-2-ylhepta-2,4-dienenitrile.
| Compound Name | (2E,4Z)-4-sulfanyl-2-thiophen-2-ylhepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 163678098 |
| Molecular Formula | C11H11NS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | (2E,4Z)-4-sulfanyl-2-thiophen-2-ylhepta-2,4-dienenitrile |
| SMILES | CC/C=C(S)/C=C(\C#N)c1cccs1 |
| InChI | InChI=1S/C11H11NS2/c1-2-4-10(13)7-9(8-12)11-5-3-6-14-11/h3-7,13H,2H2,1H3/b9-7+,10-4- |
| InChIKey | JILGYZCYSCMZIV-SGUNORKASA-N |
| XLogP | 3.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|