C19H13NS — CID 102248529
(E)-3-(1,2-dihydroacenaphthylen-5-yl)-2-thiophen-2-ylprop-2-enenitrile (PubChem CID 102248529) has the molecular formula C19H13NS and a molecular weight of 287.39 g/mol. Its IUPAC name is (E)-3-(1,2-dihydroacenaphthylen-5-yl)-2-thiophen-2-ylprop-2-enenitrile.
| Compound Name | (E)-3-(1,2-dihydroacenaphthylen-5-yl)-2-thiophen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 102248529 |
| Molecular Formula | C19H13NS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (E)-3-(1,2-dihydroacenaphthylen-5-yl)-2-thiophen-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc2c3c(cccc13)CC2)c1cccs1 |
| InChI | InChI=1S/C19H13NS/c20-12-16(18-5-2-10-21-18)11-15-9-8-14-7-6-13-3-1-4-17(15)19(13)14/h1-5,8-11H,6-7H2/b16-11+ |
| InChIKey | IVJIUTVFKBWUPT-LFIBNONCSA-N |
| XLogP | 5.06 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|