C17H13NOS — CID 881818
N-(1,2-dihydroacenaphthylen-5-yl)thiophene-2-carboxamide (PubChem CID 881818) has the molecular formula C17H13NOS and a molecular weight of 279.36 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)thiophene-2-carboxamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 881818 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c3c(cccc13)CC2)c1cccs1 |
| InChI | InChI=1S/C17H13NOS/c19-17(15-5-2-10-20-15)18-14-9-8-12-7-6-11-3-1-4-13(14)16(11)12/h1-5,8-10H,6-7H2,(H,18,19) |
| InChIKey | RJLKMVBGSMQCFG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |