C27H22N2O2S — CID 100565780
N-[(Z)-3-(1,2-dihydroacenaphthylen-5-ylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3-methylbenzamide (PubChem CID 100565780) has the molecular formula C27H22N2O2S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[(Z)-3-(1,2-dihydroacenaphthylen-5-ylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3-methylbenzamide.
| Compound Name | N-[(Z)-3-(1,2-dihydroacenaphthylen-5-ylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 100565780 |
| Molecular Formula | C27H22N2O2S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[(Z)-3-(1,2-dihydroacenaphthylen-5-ylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=C\c2cccs2)C(=O)Nc2ccc3c4c(cccc24)CC3)c1 |
| InChI | InChI=1S/C27H22N2O2S/c1-17-5-2-7-20(15-17)26(30)29-24(16-21-8-4-14-32-21)27(31)28-23-13-12-19-11-10-18-6-3-9-22(23)25(18)19/h2-9,12-16H,10-11H2,1H3,(H,28,31)(H,29,30)/b24-16- |
| InChIKey | ZBEVXNYEMPVKLH-JLPGSUDCSA-N |
| XLogP | 5.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|