C17H15F2N3O2 — CID 155328312
3-[[(1S)-3,3-difluorocyclopentyl]amino]-4-(1H-indol-3-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 155328312) has the molecular formula C17H15F2N3O2 and a molecular weight of 331.32 g/mol. Its IUPAC name is 3-[[(1S)-3,3-difluorocyclopentyl]amino]-4-(1H-indol-3-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1S)-3,3-difluorocyclopentyl]amino]-4-(1H-indol-3-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155328312 |
| Molecular Formula | C17H15F2N3O2 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-[[(1S)-3,3-difluorocyclopentyl]amino]-4-(1H-indol-3-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2c[nH]c3ccccc23)c(N[C@H]2CCC(F)(F)C2)c1=O |
| InChI | InChI=1S/C17H15F2N3O2/c18-17(19)6-5-9(7-17)21-13-14(16(24)15(13)23)22-12-8-20-11-4-2-1-3-10(11)12/h1-4,8-9,20-22H,5-7H2/t9-/m0/s1 |
| InChIKey | RSPJGKKILQNPNN-VIFPVBQESA-N |
| XLogP | 3.11 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|