C21H22O3 — CID 155329348
(E)-3-[4-[2-(3-tert-butylphenyl)-2-oxoethyl]phenyl]prop-2-enoic acid (PubChem CID 155329348) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is (E)-3-[4-[2-(3-tert-butylphenyl)-2-oxoethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(3-tert-butylphenyl)-2-oxoethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155329348 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (E)-3-[4-[2-(3-tert-butylphenyl)-2-oxoethyl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1cccc(C(=O)Cc2ccc(/C=C/C(=O)O)cc2)c1 |
| InChI | InChI=1S/C21H22O3/c1-21(2,3)18-6-4-5-17(14-18)19(22)13-16-9-7-15(8-10-16)11-12-20(23)24/h4-12,14H,13H2,1-3H3,(H,23,24)/b12-11+ |
| InChIKey | HFQDVQRBKABEQK-VAWYXSNFSA-N |
| XLogP | 4.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|