C20H25N5O3 — CID 155329737
4-[6-[[(Z)-1,3-diaminobut-2-enylidene]amino]-1,7-naphthyridin-8-yl]-1-methoxycyclohexane-1-carboxylic acid (PubChem CID 155329737) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[6-[[(Z)-1,3-diaminobut-2-enylidene]amino]-1,7-naphthyridin-8-yl]-1-methoxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[6-[[(Z)-1,3-diaminobut-2-enylidene]amino]-1,7-naphthyridin-8-yl]-1-methoxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155329737 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[6-[[(Z)-1,3-diaminobut-2-enylidene]amino]-1,7-naphthyridin-8-yl]-1-methoxycyclohexane-1-carboxylic acid |
| SMILES | COC1(C(=O)O)CCC(c2nc(/N=C(N)/C=C(/C)N)cc3cccnc23)CC1 |
| InChI | InChI=1S/C20H25N5O3/c1-12(21)10-15(22)24-16-11-14-4-3-9-23-17(14)18(25-16)13-5-7-20(28-2,8-6-13)19(26)27/h3-4,9-11,13H,5-8,21H2,1-2H3,(H,26,27)(H2,22,24,25)/b12-10- |
| InChIKey | QPRIACMKHKFRAM-BENRWUELSA-N |
| XLogP | 2.61 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|