C23H24N4O — CID 155331632
5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethyl-N-[4-(4-methylimidazol-1-yl)phenyl]aniline (PubChem CID 155331632) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethyl-N-[4-(4-methylimidazol-1-yl)phenyl]aniline.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethyl-N-[4-(4-methylimidazol-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 155331632 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethyl-N-[4-(4-methylimidazol-1-yl)phenyl]aniline |
| SMILES | Cc1cn(-c2ccc(N(C)c3cc(-c4c(C)noc4C)ccc3C)cc2)cn1 |
| InChI | InChI=1S/C23H24N4O/c1-15-6-7-19(23-17(3)25-28-18(23)4)12-22(15)26(5)20-8-10-21(11-9-20)27-13-16(2)24-14-27/h6-14H,1-5H3 |
| InChIKey | MXDAMVJPXBXCOE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|