C22H23N5O — CID 155187624
N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethyl-6-imidazol-1-ylpyridin-3-amine (PubChem CID 155187624) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethyl-6-imidazol-1-ylpyridin-3-amine.
| Compound Name | N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethyl-6-imidazol-1-ylpyridin-3-amine |
|---|---|
| PubChem CID | 155187624 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethyl-6-imidazol-1-ylpyridin-3-amine |
| SMILES | CCN(c1ccc(-n2ccnc2)nc1)c1cc(-c2c(C)noc2C)ccc1C |
| InChI | InChI=1S/C22H23N5O/c1-5-27(19-8-9-21(24-13-19)26-11-10-23-14-26)20-12-18(7-6-15(20)2)22-16(3)25-28-17(22)4/h6-14H,5H2,1-4H3 |
| InChIKey | LYANVEDCEZPLGU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|