C21H21N5O — CID 155331634
5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethyl-N-[4-(triazol-1-yl)phenyl]aniline (PubChem CID 155331634) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethyl-N-[4-(triazol-1-yl)phenyl]aniline.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethyl-N-[4-(triazol-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 155331634 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethyl-N-[4-(triazol-1-yl)phenyl]aniline |
| SMILES | Cc1ccc(-c2c(C)noc2C)cc1N(C)c1ccc(-n2ccnn2)cc1 |
| InChI | InChI=1S/C21H21N5O/c1-14-5-6-17(21-15(2)23-27-16(21)3)13-20(14)25(4)18-7-9-19(10-8-18)26-12-11-22-24-26/h5-13H,1-4H3 |
| InChIKey | ZPXVNOIUGKGOOB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|