C29H32BrN5O4 — CID 164846530
2-[2-[3-[(3-bromo-N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-imidazol-1-ylanilino)methyl]azetidin-1-yl]ethoxy]acetic acid (PubChem CID 164846530) has the molecular formula C29H32BrN5O4 and a molecular weight of 594.51 g/mol. Its IUPAC name is 2-[2-[3-[(3-bromo-N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-imidazol-1-ylanilino)methyl]azetidin-1-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[3-[(3-bromo-N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-imidazol-1-ylanilino)methyl]azetidin-1-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 164846530 |
| Molecular Formula | C29H32BrN5O4 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | 2-[2-[3-[(3-bromo-N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-imidazol-1-ylanilino)methyl]azetidin-1-yl]ethoxy]acetic acid |
| SMILES | Cc1ccc(-c2c(C)noc2C)cc1N(CC1CN(CCOCC(=O)O)C1)c1ccc(-n2ccnc2)c(Br)c1 |
| InChI | InChI=1S/C29H32BrN5O4/c1-19-4-5-23(29-20(2)32-39-21(29)3)12-27(19)35(16-22-14-33(15-22)10-11-38-17-28(36)37)24-6-7-26(25(30)13-24)34-9-8-31-18-34/h4-9,12-13,18,22H,10-11,14-17H2,1-3H3,(H,36,37) |
| InChIKey | AIZMXKQKGJGNBL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|