About N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine
N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine (PubChem CID 155187698) has the molecular formula C20H19BrN4O
and a molecular weight of 411.30 g/mol. Its IUPAC name is N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine.
Molecular Properties
| Compound Name | N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine |
| PubChem CID | 155187698 |
| Molecular Formula | C20H19BrN4O |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine |
| SMILES | CCN(c1ccc(-n2ccnc2)c(Br)c1)c1cc2c(C)noc2cc1C |
| InChI | InChI=1S/C20H19BrN4O/c1-4-25(19-11-16-14(3)23-26-20(16)9-13(19)2)15-5-6-18(17(21)10-15)24-8-7-22-12-24/h5-12H,4H2,1-3H3 |
| InChIKey | DHFNSCGVDRTVJV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine?
The IUPAC name of N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine (CID 155187698) is N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine.
What is the SMILES notation for N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine?
The canonical SMILES for N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine is CCN(c1ccc(-n2ccnc2)c(Br)c1)c1cc2c(C)noc2cc1C.
What is the InChIKey of N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine?
The InChIKey is DHFNSCGVDRTVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19BrN4O/c1-4-25(19-11-16-14(3)23-26-20(16)9-13(19)2)15-5-6-18(17(21)10-15)24-8-7-22-12-24/h5-12H,4H2,1-3H3.
What are the key properties of N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine?
N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine has a molecular weight of 411.30 g/mol, XLogP of 5.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromo-4-imidazol-1-ylphenyl)-N-ethyl-3,6-dimethyl-1,2-benzoxazol-5-amine is sourced from PubChem (CID 155187698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).