C15H22ClNO — CID 15533413
(2S)-2-chloro-3-phenyl-N,N-di(propan-2-yl)propanamide (PubChem CID 15533413) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is (2S)-2-chloro-3-phenyl-N,N-di(propan-2-yl)propanamide.
| Compound Name | (2S)-2-chloro-3-phenyl-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 15533413 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (2S)-2-chloro-3-phenyl-N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C)N(C(=O)[C@@H](Cl)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C15H22ClNO/c1-11(2)17(12(3)4)15(18)14(16)10-13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3/t14-/m0/s1 |
| InChIKey | IAVKHXMNXYUFOV-AWEZNQCLSA-N |
| XLogP | 3.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|