C34H57NO4S2 — CID 155336913
2-[2-[[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethyldisulfanyl]ethyl acetate (PubChem CID 155336913) has the molecular formula C34H57NO4S2 and a molecular weight of 607.97 g/mol. Its IUPAC name is 2-[2-[[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethyldisulfanyl]ethyl acetate.
| Compound Name | 2-[2-[[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethyldisulfanyl]ethyl acetate |
|---|---|
| PubChem CID | 155336913 |
| Molecular Formula | C34H57NO4S2 |
| Molecular Weight | 607.97 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | 2-[2-[[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethyldisulfanyl]ethyl acetate |
| SMILES | CC(=O)OCCSSCCNC(=O)O[C@H]1CC[C@@]2(C)C(=CCC3C4CCC([C@H](C)CCCC(C)C)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C34H57NO4S2/c1-23(2)8-7-9-24(3)29-12-13-30-28-11-10-26-22-27(14-16-33(26,5)31(28)15-17-34(29,30)6)39-32(37)35-18-20-40-41-21-19-38-25(4)36/h10,23-24,27-31H,7-9,11-22H2,1-6H3,(H,35,37)/t24-,27+,28?,29?,30?,31?,33+,34-/m1/s1 |
| InChIKey | DSLJVNWBELYZSU-UPEAKNPZSA-N |
| XLogP | 9.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.97 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|