C34H43N3O4 — CID 155337446
[4-[(R)-[4-(6-methylquinolin-7-yl)phenyl]-(3-morpholin-4-ylpropoxy)methyl]piperidin-1-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 155337446) has the molecular formula C34H43N3O4 and a molecular weight of 557.74 g/mol. Its IUPAC name is [4-[(R)-[4-(6-methylquinolin-7-yl)phenyl]-(3-morpholin-4-ylpropoxy)methyl]piperidin-1-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [4-[(R)-[4-(6-methylquinolin-7-yl)phenyl]-(3-morpholin-4-ylpropoxy)methyl]piperidin-1-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 155337446 |
| Molecular Formula | C34H43N3O4 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | [4-[(R)-[4-(6-methylquinolin-7-yl)phenyl]-(3-morpholin-4-ylpropoxy)methyl]piperidin-1-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | Cc1cc2cccnc2cc1-c1ccc([C@H](OCCCN2CCOCC2)C2CCN(C(=O)[C@H]3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C34H43N3O4/c1-25-23-29-5-2-13-35-31(29)24-30(25)26-7-9-27(10-8-26)33(41-20-4-14-36-17-21-39-22-18-36)28-11-15-37(16-12-28)34(38)32-6-3-19-40-32/h2,5,7-10,13,23-24,28,32-33H,3-4,6,11-12,14-22H2,1H3/t32-,33+/m1/s1 |
| InChIKey | NKHOYQNFEPLISE-SAIUNTKASA-N |
| XLogP | 5.41 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|