C27H28ClIN2O2 — CID 174171465
[4-[1-[4-(8-chloroquinolin-7-yl)phenyl]-1-iodoethyl]piperidin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 174171465) has the molecular formula C27H28ClIN2O2 and a molecular weight of 574.89 g/mol. Its IUPAC name is [4-[1-[4-(8-chloroquinolin-7-yl)phenyl]-1-iodoethyl]piperidin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[1-[4-(8-chloroquinolin-7-yl)phenyl]-1-iodoethyl]piperidin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 174171465 |
| Molecular Formula | C27H28ClIN2O2 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | [4-[1-[4-(8-chloroquinolin-7-yl)phenyl]-1-iodoethyl]piperidin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | CC(I)(c1ccc(-c2ccc3cccnc3c2Cl)cc1)C1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C27H28ClIN2O2/c1-27(29,21-12-15-31(16-13-21)26(32)23-5-3-17-33-23)20-9-6-18(7-10-20)22-11-8-19-4-2-14-30-25(19)24(22)28/h2,4,6-11,14,21,23H,3,5,12-13,15-17H2,1H3 |
| InChIKey | ZVSINOUAKMHVOR-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|