C30H36N2O4 — CID 155337464
[4-[(R)-2-methoxyethoxy-[4-(6-methylquinolin-7-yl)phenyl]methyl]piperidin-1-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 155337464) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is [4-[(R)-2-methoxyethoxy-[4-(6-methylquinolin-7-yl)phenyl]methyl]piperidin-1-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [4-[(R)-2-methoxyethoxy-[4-(6-methylquinolin-7-yl)phenyl]methyl]piperidin-1-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 155337464 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | [4-[(R)-2-methoxyethoxy-[4-(6-methylquinolin-7-yl)phenyl]methyl]piperidin-1-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | COCCO[C@@H](c1ccc(-c2cc3ncccc3cc2C)cc1)C1CCN(C(=O)[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C30H36N2O4/c1-21-19-25-5-3-13-31-27(25)20-26(21)22-7-9-23(10-8-22)29(36-18-17-34-2)24-11-14-32(15-12-24)30(33)28-6-4-16-35-28/h3,5,7-10,13,19-20,24,28-29H,4,6,11-12,14-18H2,1-2H3/t28-,29+/m1/s1 |
| InChIKey | ZVALKZIKXSQSHE-WDYNHAJCSA-N |
| XLogP | 5.33 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|