C9H9ClN4 — CID 155340641
6-chloro-2,7-dimethylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 155340641) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 6-chloro-2,7-dimethylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-2,7-dimethylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155340641 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 6-chloro-2,7-dimethylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N)c2nc(Cl)c(C)cc2n1 |
| InChI | InChI=1S/C9H9ClN4/c1-4-3-6-7(14-8(4)10)9(11)13-5(2)12-6/h3H,1-2H3,(H2,11,12,13) |
| InChIKey | XLJIOIMSZVABAI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|