C27H21N5O4 — CID 155340779
phenyl 8-amino-2-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]pyrido[3,4-d]pyrimidine-5-carboxylate (PubChem CID 155340779) has the molecular formula C27H21N5O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is phenyl 8-amino-2-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]pyrido[3,4-d]pyrimidine-5-carboxylate.
| Compound Name | phenyl 8-amino-2-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]pyrido[3,4-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 155340779 |
| Molecular Formula | C27H21N5O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | phenyl 8-amino-2-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]pyrido[3,4-d]pyrimidine-5-carboxylate |
| SMILES | CN1CC[C@@](O)(C#Cc2cccc(-c3ncc4c(C(=O)Oc5ccccc5)cnc(N)c4n3)c2)C1=O |
| InChI | InChI=1S/C27H21N5O4/c1-32-13-12-27(35,26(32)34)11-10-17-6-5-7-18(14-17)24-30-15-20-21(16-29-23(28)22(20)31-24)25(33)36-19-8-3-2-4-9-19/h2-9,14-16,35H,12-13H2,1H3,(H2,28,29)/t27-/m0/s1 |
| InChIKey | QQIBNMZJTBXGCQ-MHZLTWQESA-N |
| XLogP | 2.44 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|