C14H24N2O2 — CID 155344858
tert-butyl 3-(2-methyl-3-methylidenepyrrolidin-1-yl)azetidine-1-carboxylate (PubChem CID 155344858) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is tert-butyl 3-(2-methyl-3-methylidenepyrrolidin-1-yl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-methyl-3-methylidenepyrrolidin-1-yl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 155344858 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | tert-butyl 3-(2-methyl-3-methylidenepyrrolidin-1-yl)azetidine-1-carboxylate |
| SMILES | C=C1CCN(C2CN(C(=O)OC(C)(C)C)C2)C1C |
| InChI | InChI=1S/C14H24N2O2/c1-10-6-7-16(11(10)2)12-8-15(9-12)13(17)18-14(3,4)5/h11-12H,1,6-9H2,2-5H3 |
| InChIKey | BCVJTLDENFBJBE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|