C13H21N3O6 — CID 174813747
(carboxyamino)-[(3S)-4-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]carbamic acid (PubChem CID 174813747) has the molecular formula C13H21N3O6 and a molecular weight of 315.33 g/mol. Its IUPAC name is (carboxyamino)-[(3S)-4-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]carbamic acid.
| Compound Name | (carboxyamino)-[(3S)-4-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 174813747 |
| Molecular Formula | C13H21N3O6 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (carboxyamino)-[(3S)-4-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]carbamic acid |
| SMILES | C=C1CCN(C(=O)OC(C)(C)C)C[C@H]1N(NC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21N3O6/c1-8-5-6-15(12(21)22-13(2,3)4)7-9(8)16(11(19)20)14-10(17)18/h9,14H,1,5-7H2,2-4H3,(H,17,18)(H,19,20)/t9-/m1/s1 |
| InChIKey | NSSIPJNZYMEDOA-SECBINFHSA-N |
| XLogP | 1.71 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|