C22H22F2N4O3 — CID 155346315
[1-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]azepan-3-yl]-methylcarbamic acid (PubChem CID 155346315) has the molecular formula C22H22F2N4O3 and a molecular weight of 428.44 g/mol. Its IUPAC name is [1-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]azepan-3-yl]-methylcarbamic acid.
| Compound Name | [1-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]azepan-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 155346315 |
| Molecular Formula | C22H22F2N4O3 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [1-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]azepan-3-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CCCCN(c2nn(-c3ccc(F)cc3F)c(=O)c3ccccc23)C1 |
| InChI | InChI=1S/C22H22F2N4O3/c1-26(22(30)31)15-6-4-5-11-27(13-15)20-16-7-2-3-8-17(16)21(29)28(25-20)19-10-9-14(23)12-18(19)24/h2-3,7-10,12,15H,4-6,11,13H2,1H3,(H,30,31) |
| InChIKey | QKQYECXQBJETNW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |