C22H25FN4O3S — CID 162517161
2-(4-fluorophenyl)-1-oxo-4-[3-[2-(sulfinoamino)ethyl]azepan-1-yl]phthalazine (PubChem CID 162517161) has the molecular formula C22H25FN4O3S and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-oxo-4-[3-[2-(sulfinoamino)ethyl]azepan-1-yl]phthalazine.
| Compound Name | 2-(4-fluorophenyl)-1-oxo-4-[3-[2-(sulfinoamino)ethyl]azepan-1-yl]phthalazine |
|---|---|
| PubChem CID | 162517161 |
| Molecular Formula | C22H25FN4O3S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-(4-fluorophenyl)-1-oxo-4-[3-[2-(sulfinoamino)ethyl]azepan-1-yl]phthalazine |
| SMILES | O=c1c2ccccc2c(N2CCCCC(CCNS(=O)O)C2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN4O3S/c23-17-8-10-18(11-9-17)27-22(28)20-7-2-1-6-19(20)21(25-27)26-14-4-3-5-16(15-26)12-13-24-31(29)30/h1-2,6-11,16,24H,3-5,12-15H2,(H,29,30) |
| InChIKey | JMQKVVCHAPQDIO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|