C21H29N4O3S- — CID 162517193
2-cyclohexyl-1-oxo-4-[(3S)-3-[2-(sulfinatoamino)ethyl]piperidin-1-yl]phthalazine (PubChem CID 162517193) has the molecular formula C21H29N4O3S- and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-cyclohexyl-1-oxo-4-[(3S)-3-[2-(sulfinatoamino)ethyl]piperidin-1-yl]phthalazine.
| Compound Name | 2-cyclohexyl-1-oxo-4-[(3S)-3-[2-(sulfinatoamino)ethyl]piperidin-1-yl]phthalazine |
|---|---|
| PubChem CID | 162517193 |
| Molecular Formula | C21H29N4O3S- |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-cyclohexyl-1-oxo-4-[(3S)-3-[2-(sulfinatoamino)ethyl]piperidin-1-yl]phthalazine |
| SMILES | O=c1c2ccccc2c(N2CCC[C@@H](CCNS(=O)[O-])C2)nn1C1CCCCC1 |
| InChI | InChI=1S/C21H30N4O3S/c26-21-19-11-5-4-10-18(19)20(23-25(21)17-8-2-1-3-9-17)24-14-6-7-16(15-24)12-13-22-29(27)28/h4-5,10-11,16-17,22H,1-3,6-9,12-15H2,(H,27,28)/p-1/t16-/m0/s1 |
| InChIKey | JASZGXHQYVRYPE-INIZCTEOSA-M |
| XLogP | 2.89 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|