C21H28N4O3 — CID 175206828
[1-(3-cyclohexyl-4-oxophthalazin-1-yl)azepan-3-yl] carbamate (PubChem CID 175206828) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is [1-(3-cyclohexyl-4-oxophthalazin-1-yl)azepan-3-yl] carbamate.
| Compound Name | [1-(3-cyclohexyl-4-oxophthalazin-1-yl)azepan-3-yl] carbamate |
|---|---|
| PubChem CID | 175206828 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [1-(3-cyclohexyl-4-oxophthalazin-1-yl)azepan-3-yl] carbamate |
| SMILES | NC(=O)OC1CCCCN(c2nn(C3CCCCC3)c(=O)c3ccccc23)C1 |
| InChI | InChI=1S/C21H28N4O3/c22-21(27)28-16-10-6-7-13-24(14-16)19-17-11-4-5-12-18(17)20(26)25(23-19)15-8-2-1-3-9-15/h4-5,11-12,15-16H,1-3,6-10,13-14H2,(H2,22,27) |
| InChIKey | KBUKVBPDRGUREZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |