C12H17FO3 — CID 155346681
[(1S)-6-fluoro-6-hydroxy-2-bicyclo[2.2.1]heptanyl]methyl 2-methylprop-2-enoate (PubChem CID 155346681) has the molecular formula C12H17FO3 and a molecular weight of 228.26 g/mol. Its IUPAC name is [(1S)-6-fluoro-6-hydroxy-2-bicyclo[2.2.1]heptanyl]methyl 2-methylprop-2-enoate.
| Compound Name | [(1S)-6-fluoro-6-hydroxy-2-bicyclo[2.2.1]heptanyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155346681 |
| Molecular Formula | C12H17FO3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | [(1S)-6-fluoro-6-hydroxy-2-bicyclo[2.2.1]heptanyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CC2C[C@@H]1C(O)(F)C2 |
| InChI | InChI=1S/C12H17FO3/c1-7(2)11(14)16-6-9-3-8-4-10(9)12(13,15)5-8/h8-10,15H,1,3-6H2,2H3/t8?,9?,10-,12?/m0/s1 |
| InChIKey | HEULSQSFXHVFFJ-YZHSWQFHSA-N |
| XLogP | 1.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|