C13H22O4 — CID 156697179
(3-ethyl-2,4-dihydroxy-3-methylcyclopentyl)methyl 2-methylprop-2-enoate (PubChem CID 156697179) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (3-ethyl-2,4-dihydroxy-3-methylcyclopentyl)methyl 2-methylprop-2-enoate.
| Compound Name | (3-ethyl-2,4-dihydroxy-3-methylcyclopentyl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 156697179 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3-ethyl-2,4-dihydroxy-3-methylcyclopentyl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CC(O)C(C)(CC)C1O |
| InChI | InChI=1S/C13H22O4/c1-5-13(4)10(14)6-9(11(13)15)7-17-12(16)8(2)3/h9-11,14-15H,2,5-7H2,1,3-4H3 |
| InChIKey | QEVFWWPTUZLZGF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|