C14H25NO2 — CID 144977628
(1,2,2,3-tetramethylpiperidin-4-yl)methyl 2-methylprop-2-enoate (PubChem CID 144977628) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (1,2,2,3-tetramethylpiperidin-4-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (1,2,2,3-tetramethylpiperidin-4-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144977628 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (1,2,2,3-tetramethylpiperidin-4-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CCN(C)C(C)(C)C1C |
| InChI | InChI=1S/C14H25NO2/c1-10(2)13(16)17-9-12-7-8-15(6)14(4,5)11(12)3/h11-12H,1,7-9H2,2-6H3 |
| InChIKey | WUGHMYNRIIPYSX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|