C27H39N5O2 — CID 155347263
methyl 3-[1-[2-[4-[(2-methylindazole-4-carbonyl)amino]cyclohexyl]ethyl]-2,3,6,7-tetrahydroazepin-4-yl]propanimidate (PubChem CID 155347263) has the molecular formula C27H39N5O2 and a molecular weight of 465.64 g/mol. Its IUPAC name is methyl 3-[1-[2-[4-[(2-methylindazole-4-carbonyl)amino]cyclohexyl]ethyl]-2,3,6,7-tetrahydroazepin-4-yl]propanimidate.
| Compound Name | methyl 3-[1-[2-[4-[(2-methylindazole-4-carbonyl)amino]cyclohexyl]ethyl]-2,3,6,7-tetrahydroazepin-4-yl]propanimidate |
|---|---|
| PubChem CID | 155347263 |
| Molecular Formula | C27H39N5O2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | methyl 3-[1-[2-[4-[(2-methylindazole-4-carbonyl)amino]cyclohexyl]ethyl]-2,3,6,7-tetrahydroazepin-4-yl]propanimidate |
| SMILES | [H]/N=C(/CCC1=CCCN(CCC2CCC(NC(=O)c3cccc4nn(C)cc34)CC2)CC1)OC |
| InChI | InChI=1S/C27H39N5O2/c1-31-19-24-23(6-3-7-25(24)30-31)27(33)29-22-11-8-21(9-12-22)15-18-32-16-4-5-20(14-17-32)10-13-26(28)34-2/h3,5-7,19,21-22,28H,4,8-18H2,1-2H3,(H,29,33)/b28-26- |
| InChIKey | DXDSYXMQHJJNKB-SGEDCAFJSA-N |
| XLogP | 4.68 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|