C20H37FN2O — CID 155347373
(3Z,5Z)-1-N-(2-cyclohexylethyl)-4-ethyl-7-(2-fluoroethoxy)-3-N-methylhepta-3,5-diene-1,3-diamine (PubChem CID 155347373) has the molecular formula C20H37FN2O and a molecular weight of 340.53 g/mol. Its IUPAC name is (3Z,5Z)-1-N-(2-cyclohexylethyl)-4-ethyl-7-(2-fluoroethoxy)-3-N-methylhepta-3,5-diene-1,3-diamine.
| Compound Name | (3Z,5Z)-1-N-(2-cyclohexylethyl)-4-ethyl-7-(2-fluoroethoxy)-3-N-methylhepta-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 155347373 |
| Molecular Formula | C20H37FN2O |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | (3Z,5Z)-1-N-(2-cyclohexylethyl)-4-ethyl-7-(2-fluoroethoxy)-3-N-methylhepta-3,5-diene-1,3-diamine |
| SMILES | CCC(/C=C\COCCF)=C(\CCNCCC1CCCCC1)NC |
| InChI | InChI=1S/C20H37FN2O/c1-3-19(10-7-16-24-17-13-21)20(22-2)12-15-23-14-11-18-8-5-4-6-9-18/h7,10,18,22-23H,3-6,8-9,11-17H2,1-2H3/b10-7-,20-19- |
| InChIKey | HDWUOITZACNARF-SVGVNVSTSA-N |
| XLogP | 4.36 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|