C23H36N2O — CID 142952586
2-(aminomethyl)-6-[(Z,2E)-2-ethylidenepent-3-enoxy]-N-propyl-3,3a-dihydro-2H-inden-1-amine;prop-1-ene (PubChem CID 142952586) has the molecular formula C23H36N2O and a molecular weight of 356.55 g/mol. Its IUPAC name is 2-(aminomethyl)-6-[(Z,2E)-2-ethylidenepent-3-enoxy]-N-propyl-3,3a-dihydro-2H-inden-1-amine;prop-1-ene.
| Compound Name | 2-(aminomethyl)-6-[(Z,2E)-2-ethylidenepent-3-enoxy]-N-propyl-3,3a-dihydro-2H-inden-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 142952586 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | 2-(aminomethyl)-6-[(Z,2E)-2-ethylidenepent-3-enoxy]-N-propyl-3,3a-dihydro-2H-inden-1-amine;prop-1-ene |
| SMILES | C/C=C\C(=C/C)COC1=CC2=C(NCCC)C(CN)CC2C=C1.C=CC |
| InChI | InChI=1S/C20H30N2O.C3H6/c1-4-7-15(6-3)14-23-18-9-8-16-11-17(13-21)20(19(16)12-18)22-10-5-2;1-3-2/h4,6-9,12,16-17,22H,5,10-11,13-14,21H2,1-3H3;3H,1H2,2H3/b7-4-,15-6+; |
| InChIKey | RNYCYDYCLZMGAZ-UUZQLBDQSA-N |
| XLogP | 5.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|