C20H30N2O — CID 142952587
2-(aminomethyl)-6-[(Z,2E)-2-ethylidenepent-3-enoxy]-N-propyl-3,3a-dihydro-2H-inden-1-amine (PubChem CID 142952587) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(aminomethyl)-6-[(Z,2E)-2-ethylidenepent-3-enoxy]-N-propyl-3,3a-dihydro-2H-inden-1-amine.
| Compound Name | 2-(aminomethyl)-6-[(Z,2E)-2-ethylidenepent-3-enoxy]-N-propyl-3,3a-dihydro-2H-inden-1-amine |
|---|---|
| PubChem CID | 142952587 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 2-(aminomethyl)-6-[(Z,2E)-2-ethylidenepent-3-enoxy]-N-propyl-3,3a-dihydro-2H-inden-1-amine |
| SMILES | C/C=C\C(=C/C)COC1=CC2=C(NCCC)C(CN)CC2C=C1 |
| InChI | InChI=1S/C20H30N2O/c1-4-7-15(6-3)14-23-18-9-8-16-11-17(13-21)20(19(16)12-18)22-10-5-2/h4,6-9,12,16-17,22H,5,10-11,13-14,21H2,1-3H3/b7-4-,15-6+ |
| InChIKey | PEWNBDPIDFUKOQ-XWBOZUFGSA-N |
| XLogP | 3.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|