C12H16N2O — CID 175610469
6-methoxy-2,3,4,5,9,9a-hexahydro-1H-pyrido[4,3-b]indole (PubChem CID 175610469) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 6-methoxy-2,3,4,5,9,9a-hexahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 6-methoxy-2,3,4,5,9,9a-hexahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 175610469 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 6-methoxy-2,3,4,5,9,9a-hexahydro-1H-pyrido[4,3-b]indole |
| SMILES | COC1=C2NC3=C(CNCC3)C2CC=C1 |
| InChI | InChI=1S/C12H16N2O/c1-15-11-4-2-3-8-9-7-13-6-5-10(9)14-12(8)11/h2,4,8,13-14H,3,5-7H2,1H3 |
| InChIKey | LNERKLATGKALHH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |