C13H16N2O — CID 166963824
7-methoxy-1-methylidene-2,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole (PubChem CID 166963824) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 7-methoxy-1-methylidene-2,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole.
| Compound Name | 7-methoxy-1-methylidene-2,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 166963824 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 7-methoxy-1-methylidene-2,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole |
| SMILES | C=C1NCCC2=C1NC1C=C(OC)C=CC21 |
| InChI | InChI=1S/C13H16N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-4,7,10,12,14-15H,1,5-6H2,2H3 |
| InChIKey | ZARPGBSWMXGEAW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |