C22H13ClF3N5O2 — CID 155347920
1-(4-chlorophenyl)-3-([1,2,4]triazolo[4,3-a]pyridin-6-yl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one (PubChem CID 155347920) has the molecular formula C22H13ClF3N5O2 and a molecular weight of 471.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-([1,2,4]triazolo[4,3-a]pyridin-6-yl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one.
| Compound Name | 1-(4-chlorophenyl)-3-([1,2,4]triazolo[4,3-a]pyridin-6-yl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 155347920 |
| Molecular Formula | C22H13ClF3N5O2 |
| Molecular Weight | 471.83 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-([1,2,4]triazolo[4,3-a]pyridin-6-yl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one |
| SMILES | O=c1c(-c2ccc3nncn3c2)cc2ccc(OCC(F)(F)F)nc2n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H13ClF3N5O2/c23-15-3-5-16(6-4-15)31-20-13(2-8-19(28-20)33-11-22(24,25)26)9-17(21(31)32)14-1-7-18-29-27-12-30(18)10-14/h1-10,12H,11H2 |
| InChIKey | JDDRGUDDWIPLLC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |