C27H27F3N4O3 — CID 155732497
3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-methoxyphenyl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one;ethane (PubChem CID 155732497) has the molecular formula C27H27F3N4O3 and a molecular weight of 512.53 g/mol. Its IUPAC name is 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-methoxyphenyl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one;ethane.
| Compound Name | 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-methoxyphenyl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one;ethane |
|---|---|
| PubChem CID | 155732497 |
| Molecular Formula | C27H27F3N4O3 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-methoxyphenyl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one;ethane |
| SMILES | C/N=C/c1cc(-c2cc3ccc(OCC(F)(F)F)nc3n(-c3ccc(OC)cc3)c2=O)ccc1N.CC |
| InChI | InChI=1S/C25H21F3N4O3.C2H6/c1-30-13-17-11-15(3-9-21(17)29)20-12-16-4-10-22(35-14-25(26,27)28)31-23(16)32(24(20)33)18-5-7-19(34-2)8-6-18;1-2/h3-13H,14,29H2,1-2H3;1-2H3/b30-13+; |
| InChIKey | IANVHVMZWFPGEH-KNZOYEIVSA-N |
| XLogP | 5.66 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|