C24H18ClF3N4O2 — CID 155347783
3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-chlorophenyl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one (PubChem CID 155347783) has the molecular formula C24H18ClF3N4O2 and a molecular weight of 486.88 g/mol. Its IUPAC name is 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-chlorophenyl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one.
| Compound Name | 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-chlorophenyl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 155347783 |
| Molecular Formula | C24H18ClF3N4O2 |
| Molecular Weight | 486.88 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-chlorophenyl)-7-(2,2,2-trifluoroethoxy)-1,8-naphthyridin-2-one |
| SMILES | C/N=C/c1cc(-c2cc3ccc(OCC(F)(F)F)nc3n(-c3ccc(Cl)cc3)c2=O)ccc1N |
| InChI | InChI=1S/C24H18ClF3N4O2/c1-30-12-16-10-14(2-8-20(16)29)19-11-15-3-9-21(34-13-24(26,27)28)31-22(15)32(23(19)33)18-6-4-17(25)5-7-18/h2-12H,13,29H2,1H3/b30-12+ |
| InChIKey | XPAZPHKCVVHMCL-PNQUVVCRSA-N |
| XLogP | 5.28 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.88 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|