C30H26F3N7O2 — CID 167272538
6-[4-amino-3-(methyliminomethyl)phenyl]-8-[3-(2-phenylethoxy)phenyl]-2-(2,2,2-trifluoroethylamino)pteridin-7-one (PubChem CID 167272538) has the molecular formula C30H26F3N7O2 and a molecular weight of 573.58 g/mol. Its IUPAC name is 6-[4-amino-3-(methyliminomethyl)phenyl]-8-[3-(2-phenylethoxy)phenyl]-2-(2,2,2-trifluoroethylamino)pteridin-7-one.
| Compound Name | 6-[4-amino-3-(methyliminomethyl)phenyl]-8-[3-(2-phenylethoxy)phenyl]-2-(2,2,2-trifluoroethylamino)pteridin-7-one |
|---|---|
| PubChem CID | 167272538 |
| Molecular Formula | C30H26F3N7O2 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 6-[4-amino-3-(methyliminomethyl)phenyl]-8-[3-(2-phenylethoxy)phenyl]-2-(2,2,2-trifluoroethylamino)pteridin-7-one |
| SMILES | C/N=C/c1cc(-c2nc3cnc(NCC(F)(F)F)nc3n(-c3cccc(OCCc4ccccc4)c3)c2=O)ccc1N |
| InChI | InChI=1S/C30H26F3N7O2/c1-35-16-21-14-20(10-11-24(21)34)26-28(41)40(27-25(38-26)17-36-29(39-27)37-18-30(31,32)33)22-8-5-9-23(15-22)42-13-12-19-6-3-2-4-7-19/h2-11,14-17H,12-13,18,34H2,1H3,(H,36,37,39)/b35-16+ |
| InChIKey | LHHSVSFUYVVVTI-QNVXDBMFSA-N |
| XLogP | 5.07 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|