C22H20F3N7O2 — CID 155732379
6-(6-imino-1-methanimidoyl-3-pyridinyl)-8-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)pyrido[2,3-d]pyrimidin-7-one;molecular hydrogen (PubChem CID 155732379) has the molecular formula C22H20F3N7O2 and a molecular weight of 471.44 g/mol. Its IUPAC name is 6-(6-imino-1-methanimidoyl-3-pyridinyl)-8-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)pyrido[2,3-d]pyrimidin-7-one;molecular hydrogen.
| Compound Name | 6-(6-imino-1-methanimidoyl-3-pyridinyl)-8-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)pyrido[2,3-d]pyrimidin-7-one;molecular hydrogen |
|---|---|
| PubChem CID | 155732379 |
| Molecular Formula | C22H20F3N7O2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 6-(6-imino-1-methanimidoyl-3-pyridinyl)-8-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)pyrido[2,3-d]pyrimidin-7-one;molecular hydrogen |
| SMILES | [H]/N=C/n1cc(-c2cc3cnc(NCC(F)(F)F)nc3n(-c3ccc(OC)cc3)c2=O)cc/c1=N\[H].[H][H] |
| InChI | InChI=1S/C22H18F3N7O2.H2/c1-34-16-5-3-15(4-6-16)32-19-14(9-28-21(30-19)29-11-22(23,24)25)8-17(20(32)33)13-2-7-18(27)31(10-13)12-26;/h2-10,12,26-27H,11H2,1H3,(H,28,29,30);1H/b26-12+,27-18+; |
| InChIKey | FXUDFAZCWVLWIA-QBZVVYQHSA-N |
| XLogP | 3.41 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|