C25H29N5O3 — CID 155732452
ethane;7-ethoxy-3-(6-imino-1-methanimidoyl-3-pyridinyl)-1-(4-methoxyphenyl)-7,8-dihydro-1,8-naphthyridin-2-one (PubChem CID 155732452) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethane;7-ethoxy-3-(6-imino-1-methanimidoyl-3-pyridinyl)-1-(4-methoxyphenyl)-7,8-dihydro-1,8-naphthyridin-2-one.
| Compound Name | ethane;7-ethoxy-3-(6-imino-1-methanimidoyl-3-pyridinyl)-1-(4-methoxyphenyl)-7,8-dihydro-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 155732452 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | ethane;7-ethoxy-3-(6-imino-1-methanimidoyl-3-pyridinyl)-1-(4-methoxyphenyl)-7,8-dihydro-1,8-naphthyridin-2-one |
| SMILES | CC.[H]/N=C/n1cc(-c2cc3c(n(-c4ccc(OC)cc4)c2=O)NC(OCC)C=C3)cc/c1=N\[H] |
| InChI | InChI=1S/C23H23N5O3.C2H6/c1-3-31-21-11-5-15-12-19(16-4-10-20(25)27(13-16)14-24)23(29)28(22(15)26-21)17-6-8-18(30-2)9-7-17;1-2/h4-14,21,24-26H,3H2,1-2H3;1-2H3/b24-14+,25-20+; |
| InChIKey | NPRJZFSHMMHVNM-GOPDOTORSA-N |
| XLogP | 4.08 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|