C27H29F3N4O4 — CID 155732492
6-(2,2-dimethyl-1,3-benzodioxol-5-yl)-8-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)-1,2-dihydropyrido[2,3-d]pyrimidin-7-one;ethane (PubChem CID 155732492) has the molecular formula C27H29F3N4O4 and a molecular weight of 530.55 g/mol. Its IUPAC name is 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)-8-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)-1,2-dihydropyrido[2,3-d]pyrimidin-7-one;ethane.
| Compound Name | 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)-8-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)-1,2-dihydropyrido[2,3-d]pyrimidin-7-one;ethane |
|---|---|
| PubChem CID | 155732492 |
| Molecular Formula | C27H29F3N4O4 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)-8-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)-1,2-dihydropyrido[2,3-d]pyrimidin-7-one;ethane |
| SMILES | CC.COc1ccc(-n2c3c(cc(-c4ccc5c(c4)OC(C)(C)O5)c2=O)C=NC(NCC(F)(F)F)N3)cc1 |
| InChI | InChI=1S/C25H23F3N4O4.C2H6/c1-24(2)35-19-9-4-14(11-20(19)36-24)18-10-15-12-29-23(30-13-25(26,27)28)31-21(15)32(22(18)33)16-5-7-17(34-3)8-6-16;1-2/h4-12,23,30-31H,13H2,1-3H3;1-2H3 |
| InChIKey | CGQLSYYUIOXALL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |