C24H28BrFN6O4 — CID 155348226
tert-butyl 3-[6-bromo-5-fluoro-3-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate (PubChem CID 155348226) has the molecular formula C24H28BrFN6O4 and a molecular weight of 563.43 g/mol. Its IUPAC name is tert-butyl 3-[6-bromo-5-fluoro-3-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-bromo-5-fluoro-3-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155348226 |
| Molecular Formula | C24H28BrFN6O4 |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | tert-butyl 3-[6-bromo-5-fluoro-3-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(n2c(=O)n(Cc3ccc(C(=O)NN)cn3)c3cc(F)c(Br)cc32)C1 |
| InChI | InChI=1S/C24H28BrFN6O4/c1-24(2,3)36-23(35)30-8-4-5-16(13-30)32-20-9-17(25)18(26)10-19(20)31(22(32)34)12-15-7-6-14(11-28-15)21(33)29-27/h6-7,9-11,16H,4-5,8,12-13,27H2,1-3H3,(H,29,33) |
| InChIKey | LLNQLIGYPSEBGT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|