C23H27F3N4O3 — CID 155349566
2-hydroxy-4-(N-methanimidoyl-2-methyl-4-piperidin-4-ylanilino)-6-methoxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 155349566) has the molecular formula C23H27F3N4O3 and a molecular weight of 464.49 g/mol. Its IUPAC name is 2-hydroxy-4-(N-methanimidoyl-2-methyl-4-piperidin-4-ylanilino)-6-methoxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-hydroxy-4-(N-methanimidoyl-2-methyl-4-piperidin-4-ylanilino)-6-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 155349566 |
| Molecular Formula | C23H27F3N4O3 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-hydroxy-4-(N-methanimidoyl-2-methyl-4-piperidin-4-ylanilino)-6-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | [H]/N=C/N(c1cc(O)c(C(=O)NCC(F)(F)F)c(OC)c1)c1ccc(C2CCNCC2)cc1C |
| InChI | InChI=1S/C23H27F3N4O3/c1-14-9-16(15-5-7-28-8-6-15)3-4-18(14)30(13-27)17-10-19(31)21(20(11-17)33-2)22(32)29-12-23(24,25)26/h3-4,9-11,13,15,27-28,31H,5-8,12H2,1-2H3,(H,29,32)/b27-13+ |
| InChIKey | MPZIEQWDRHEFOH-UVHMKAGCSA-N |
| XLogP | 4.21 |
| TPSA | 97.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|