C24H27F3N4O3 — CID 174364174
2,7-dimethoxy-4-(5-piperidin-4-ylbenzimidazol-1-yl)-N-(2,2,2-trifluoroethyl)cyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 174364174) has the molecular formula C24H27F3N4O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is 2,7-dimethoxy-4-(5-piperidin-4-ylbenzimidazol-1-yl)-N-(2,2,2-trifluoroethyl)cyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | 2,7-dimethoxy-4-(5-piperidin-4-ylbenzimidazol-1-yl)-N-(2,2,2-trifluoroethyl)cyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 174364174 |
| Molecular Formula | C24H27F3N4O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2,7-dimethoxy-4-(5-piperidin-4-ylbenzimidazol-1-yl)-N-(2,2,2-trifluoroethyl)cyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | COC1=CCC(n2cnc3cc(C4CCNCC4)ccc32)=CC(OC)=C1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H27F3N4O3/c1-33-20-6-4-17(12-21(34-2)22(20)23(32)29-13-24(25,26)27)31-14-30-18-11-16(3-5-19(18)31)15-7-9-28-10-8-15/h3,5-6,11-12,14-15,28H,4,7-10,13H2,1-2H3,(H,29,32) |
| InChIKey | LEFMIDRDJKADBL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |