C18H23N5O4 — CID 155350427
tert-butyl 8-carbamoyl-4-oxa-3,10,11,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2,5,11-tetraene-15-carboxylate (PubChem CID 155350427) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is tert-butyl 8-carbamoyl-4-oxa-3,10,11,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2,5,11-tetraene-15-carboxylate.
| Compound Name | tert-butyl 8-carbamoyl-4-oxa-3,10,11,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2,5,11-tetraene-15-carboxylate |
|---|---|
| PubChem CID | 155350427 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | tert-butyl 8-carbamoyl-4-oxa-3,10,11,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2,5,11-tetraene-15-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nn3c(c2C1)-c1nocc1CC(C(N)=O)C3 |
| InChI | InChI=1S/C18H23N5O4/c1-18(2,3)27-17(25)22-5-4-13-12(8-22)15-14-11(9-26-21-14)6-10(16(19)24)7-23(15)20-13/h9-10H,4-8H2,1-3H3,(H2,19,24) |
| InChIKey | VSVDUJJDLLRIEX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |