C25H42N6O5 — CID 155350872
[4-[3-(5-azidopentanoylamino)propanoyl]-1-(3,3-dimethyl-2-oxopentyl)piperazin-2-yl]methyl 1-methylcyclopropane-1-carboxylate (PubChem CID 155350872) has the molecular formula C25H42N6O5 and a molecular weight of 506.65 g/mol. Its IUPAC name is [4-[3-(5-azidopentanoylamino)propanoyl]-1-(3,3-dimethyl-2-oxopentyl)piperazin-2-yl]methyl 1-methylcyclopropane-1-carboxylate.
| Compound Name | [4-[3-(5-azidopentanoylamino)propanoyl]-1-(3,3-dimethyl-2-oxopentyl)piperazin-2-yl]methyl 1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 155350872 |
| Molecular Formula | C25H42N6O5 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | [4-[3-(5-azidopentanoylamino)propanoyl]-1-(3,3-dimethyl-2-oxopentyl)piperazin-2-yl]methyl 1-methylcyclopropane-1-carboxylate |
| SMILES | CCC(C)(C)C(=O)CN1CCN(C(=O)CCNC(=O)CCCCN=[N+]=[N-])CC1COC(=O)C1(C)CC1 |
| InChI | InChI=1S/C25H42N6O5/c1-5-24(2,3)20(32)17-30-14-15-31(16-19(30)18-36-23(35)25(4)10-11-25)22(34)9-13-27-21(33)8-6-7-12-28-29-26/h19H,5-18H2,1-4H3,(H,27,33) |
| InChIKey | BPACOQXKIYXYTO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|