C16H29N7O4 — CID 172612180
tert-butyl N-[[4-(6-azidohexanoyl)piperazine-1-carbonyl]amino]carbamate (PubChem CID 172612180) has the molecular formula C16H29N7O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is tert-butyl N-[[4-(6-azidohexanoyl)piperazine-1-carbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[[4-(6-azidohexanoyl)piperazine-1-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 172612180 |
| Molecular Formula | C16H29N7O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl N-[[4-(6-azidohexanoyl)piperazine-1-carbonyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)N1CCN(C(=O)CCCCCN=[N+]=[N-])CC1 |
| InChI | InChI=1S/C16H29N7O4/c1-16(2,3)27-15(26)20-19-14(25)23-11-9-22(10-12-23)13(24)7-5-4-6-8-18-21-17/h4-12H2,1-3H3,(H,19,25)(H,20,26) |
| InChIKey | XZUQJWMJDZWMQA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|