About [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate
[4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate (PubChem CID 174985332) has the molecular formula C14H25N5O4
and a molecular weight of 327.39 g/mol. Its IUPAC name is [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate.
Molecular Properties
| Compound Name | [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate |
| PubChem CID | 174985332 |
| Molecular Formula | C14H25N5O4 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate |
| SMILES | COCC(=O)OCN1CCN(C(=O)CCCCCN=[N+]=[N-])CC1 |
| InChI | InChI=1S/C14H25N5O4/c1-22-11-14(21)23-12-18-7-9-19(10-8-18)13(20)5-3-2-4-6-16-17-15/h2-12H2,1H3 |
| InChIKey | WYFQMLQPMQCFLW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 107.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate?
The IUPAC name of [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate (CID 174985332) is [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate.
What is the SMILES notation for [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate?
The canonical SMILES for [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate is COCC(=O)OCN1CCN(C(=O)CCCCCN=[N+]=[N-])CC1.
What is the InChIKey of [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate?
The InChIKey is WYFQMLQPMQCFLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5O4/c1-22-11-14(21)23-12-18-7-9-19(10-8-18)13(20)5-3-2-4-6-16-17-15/h2-12H2,1H3.
What are the key properties of [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate?
[4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate has a molecular weight of 327.39 g/mol, XLogP of 1.15, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6-azidohexanoyl)piperazin-1-yl]methyl 2-methoxyacetate is sourced from PubChem (CID 174985332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).