C19H34N8O6 — CID 146174292
2-[4-(2-amino-2-oxoethyl)-10-(5-azidopentanoyl)-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 146174292) has the molecular formula C19H34N8O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[4-(2-amino-2-oxoethyl)-10-(5-azidopentanoyl)-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-(2-amino-2-oxoethyl)-10-(5-azidopentanoyl)-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 146174292 |
| Molecular Formula | C19H34N8O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 2-[4-(2-amino-2-oxoethyl)-10-(5-azidopentanoyl)-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | [N-]=[N+]=NCCCCC(=O)N1CCN(CC(=O)O)CCN(CC(N)=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C19H34N8O6/c20-16(28)13-24-5-7-25(14-18(30)31)9-11-27(17(29)3-1-2-4-22-23-21)12-10-26(8-6-24)15-19(32)33/h1-15H2,(H2,20,28)(H,30,31)(H,32,33) |
| InChIKey | WNNLJQLSOUPAEI-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|