C29H53N19O4 — CID 159982769
2-[4-(6-azido-2-oxohexyl)-7,10-bis[2-(3-azidopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-(3-azidopropyl)acetamide (PubChem CID 159982769) has the molecular formula C29H53N19O4 and a molecular weight of 731.87 g/mol. Its IUPAC name is 2-[4-(6-azido-2-oxohexyl)-7,10-bis[2-(3-azidopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-(3-azidopropyl)acetamide.
| Compound Name | 2-[4-(6-azido-2-oxohexyl)-7,10-bis[2-(3-azidopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-(3-azidopropyl)acetamide |
|---|---|
| PubChem CID | 159982769 |
| Molecular Formula | C29H53N19O4 |
| Molecular Weight | 731.87 g/mol |
| Exact Mass | 731.45 |
| IUPAC Name | 2-[4-(6-azido-2-oxohexyl)-7,10-bis[2-(3-azidopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-(3-azidopropyl)acetamide |
| SMILES | [N-]=[N+]=NCCCCC(=O)CN1CCN(CC(=O)NCCCN=[N+]=[N-])CCN(CC(=O)NCCCN=[N+]=[N-])CCN(CC(=O)NCCCN=[N+]=[N-])CC1 |
| InChI | InChI=1S/C29H53N19O4/c30-41-37-10-2-1-6-26(49)22-45-14-16-46(23-27(50)34-7-3-11-38-42-31)18-20-48(25-29(52)36-9-5-13-40-44-33)21-19-47(17-15-45)24-28(51)35-8-4-12-39-43-32/h1-25H2,(H,34,50)(H,35,51)(H,36,52) |
| InChIKey | OFZDMPYVWZJOJK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 312.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.87 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|